C26H46Ru — CID 173040884
bis((Z)-5-methanidylidene-2,2,3,6,6-pentamethylhept-3-ene);ruthenium(2+) (PubChem CID 173040884) has the molecular formula C26H46Ru and a molecular weight of 459.72 g/mol. Its IUPAC name is bis((Z)-5-methanidylidene-2,2,3,6,6-pentamethylhept-3-ene);ruthenium(2+).
| Compound Name | bis((Z)-5-methanidylidene-2,2,3,6,6-pentamethylhept-3-ene);ruthenium(2+) |
|---|---|
| PubChem CID | 173040884 |
| Molecular Formula | C26H46Ru |
| Molecular Weight | 459.72 g/mol |
| Exact Mass | 460.26 |
| IUPAC Name | bis((Z)-5-methanidylidene-2,2,3,6,6-pentamethylhept-3-ene);ruthenium(2+) |
| SMILES | [H]/[C-]=C(\C=C(\C)C(C)(C)C)C(C)(C)C.[H]/[C-]=C(\C=C(\C)C(C)(C)C)C(C)(C)C.[Ru+2] |
| InChI | InChI=1S/2C13H23.Ru/c2*1-10(12(3,4)5)9-11(2)13(6,7)8;/h2*1,9H,2-8H3;/q2*-1;+2/b2*11-9-; |
| InChIKey | IEKXCOCMJHUZJU-UNNWALPCSA-N |
| XLogP | 8.77 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.72 |
| LogP ≤ 5 | 8.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|