C11H17N — CID 134995446
(2E,4E)-3,5,6,6-tetramethylhepta-2,4-dienenitrile (PubChem CID 134995446) has the molecular formula C11H17N and a molecular weight of 163.26 g/mol. Its IUPAC name is (2E,4E)-3,5,6,6-tetramethylhepta-2,4-dienenitrile.
| Compound Name | (2E,4E)-3,5,6,6-tetramethylhepta-2,4-dienenitrile |
|---|---|
| PubChem CID | 134995446 |
| Molecular Formula | C11H17N |
| Molecular Weight | 163.26 g/mol |
| Exact Mass | 163.14 |
| IUPAC Name | (2E,4E)-3,5,6,6-tetramethylhepta-2,4-dienenitrile |
| SMILES | CC(=C\C#N)/C=C(\C)C(C)(C)C |
| InChI | InChI=1S/C11H17N/c1-9(6-7-12)8-10(2)11(3,4)5/h6,8H,1-5H3/b9-6+,10-8+ |
| InChIKey | BILMCHUUNQGRPA-OAMUUVBCSA-N |
| XLogP | 3.45 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.26 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|