C8H8N2 — CID 5371890
(2Z,4Z)-3,4-dimethylhexa-2,4-dienedinitrile (PubChem CID 5371890) has the molecular formula C8H8N2 and a molecular weight of 132.17 g/mol. Its IUPAC name is (2Z,4Z)-3,4-dimethylhexa-2,4-dienedinitrile.
| Compound Name | (2Z,4Z)-3,4-dimethylhexa-2,4-dienedinitrile |
|---|---|
| PubChem CID | 5371890 |
| Molecular Formula | C8H8N2 |
| Molecular Weight | 132.17 g/mol |
| Exact Mass | 132.07 |
| IUPAC Name | (2Z,4Z)-3,4-dimethylhexa-2,4-dienedinitrile |
| SMILES | CC(=C/C#N)/C(C)=C\C#N |
| InChI | InChI=1S/C8H8N2/c1-7(3-5-9)8(2)4-6-10/h3-4H,1-2H3/b7-3-,8-4- |
| InChIKey | NVTXFMSSZHCUII-VHOZIDCHSA-N |
| XLogP | 1.93 |
| TPSA | 47.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 132.17 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|