About 2-cyclopenta-2,4-dien-1-ylidenepropanedinitrile
2-cyclopenta-2,4-dien-1-ylidenepropanedinitrile (PubChem CID 19901251) has the molecular formula C8H4N2
and a molecular weight of 128.13 g/mol. Its IUPAC name is 2-cyclopenta-2,4-dien-1-ylidenepropanedinitrile.
Molecular Properties
| Compound Name | 2-cyclopenta-2,4-dien-1-ylidenepropanedinitrile |
| PubChem CID | 19901251 |
| Molecular Formula | C8H4N2 |
| Molecular Weight | 128.13 g/mol |
| Exact Mass | 128.04 |
| IUPAC Name | 2-cyclopenta-2,4-dien-1-ylidenepropanedinitrile |
| SMILES | N#CC(C#N)=C1C=CC=C1 |
| InChI | InChI=1S/C8H4N2/c9-5-8(6-10)7-3-1-2-4-7/h1-4H |
| InChIKey | QYWDYGGZIARXGC-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 47.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 128.13 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|
Analyze 2-cyclopenta-2,4-dien-1-ylidenepropanedinitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyclopenta-2,4-dien-1-ylidenepropanedinitrile?
The IUPAC name of 2-cyclopenta-2,4-dien-1-ylidenepropanedinitrile (CID 19901251) is 2-cyclopenta-2,4-dien-1-ylidenepropanedinitrile.
What is the SMILES notation for 2-cyclopenta-2,4-dien-1-ylidenepropanedinitrile?
The canonical SMILES for 2-cyclopenta-2,4-dien-1-ylidenepropanedinitrile is N#CC(C#N)=C1C=CC=C1.
What is the InChIKey of 2-cyclopenta-2,4-dien-1-ylidenepropanedinitrile?
The InChIKey is QYWDYGGZIARXGC-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H4N2/c9-5-8(6-10)7-3-1-2-4-7/h1-4H.
What are the key properties of 2-cyclopenta-2,4-dien-1-ylidenepropanedinitrile?
2-cyclopenta-2,4-dien-1-ylidenepropanedinitrile has a molecular weight of 128.13 g/mol, XLogP of 1.46, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyclopenta-2,4-dien-1-ylidenepropanedinitrile is sourced from PubChem (CID 19901251), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).