C7H4N2 — CID 12846953
cyclopenta-1,3-diene-1,3-dicarbonitrile (PubChem CID 12846953) has the molecular formula C7H4N2 and a molecular weight of 116.12 g/mol. Its IUPAC name is cyclopenta-1,3-diene-1,3-dicarbonitrile.
| Compound Name | cyclopenta-1,3-diene-1,3-dicarbonitrile |
|---|---|
| PubChem CID | 12846953 |
| Molecular Formula | C7H4N2 |
| Molecular Weight | 116.12 g/mol |
| Exact Mass | 116.04 |
| IUPAC Name | cyclopenta-1,3-diene-1,3-dicarbonitrile |
| SMILES | N#CC1=CCC(C#N)=C1 |
| InChI | InChI=1S/C7H4N2/c8-4-6-1-2-7(3-6)5-9/h1,3H,2H2 |
| InChIKey | VEPRCMDQUCNDKY-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 47.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 116.12 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |