About N-but-2-en-2-ylmethanimine;uranium;vanadium
N-but-2-en-2-ylmethanimine;uranium;vanadium (PubChem CID 59967511) has the molecular formula C5H7NUV-2
and a molecular weight of 370.09 g/mol. Its IUPAC name is N-but-2-en-2-ylmethanimine;uranium;vanadium.
Molecular Properties
| Compound Name | N-but-2-en-2-ylmethanimine;uranium;vanadium |
| PubChem CID | 59967511 |
| Molecular Formula | C5H7NUV-2 |
| Molecular Weight | 370.09 g/mol |
| Exact Mass | 370.05 |
| IUPAC Name | N-but-2-en-2-ylmethanimine;uranium;vanadium |
| SMILES | [H]/[C-]=N\C(C)=[C-]/C.[U].[V] |
| InChI | InChI=1S/C5H7N.U.V/c1-4-5(2)6-3;;/h3H,1-2H3;;/q-2;; |
| InChIKey | LVNBCVWIWNKNAI-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 370.09 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze N-but-2-en-2-ylmethanimine;uranium;vanadium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-but-2-en-2-ylmethanimine;uranium;vanadium?
The IUPAC name of N-but-2-en-2-ylmethanimine;uranium;vanadium (CID 59967511) is N-but-2-en-2-ylmethanimine;uranium;vanadium.
What is the SMILES notation for N-but-2-en-2-ylmethanimine;uranium;vanadium?
The canonical SMILES for N-but-2-en-2-ylmethanimine;uranium;vanadium is [H]/[C-]=N\C(C)=[C-]/C.[U].[V].
What is the InChIKey of N-but-2-en-2-ylmethanimine;uranium;vanadium?
The InChIKey is LVNBCVWIWNKNAI-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H7N.U.V/c1-4-5(2)6-3;;/h3H,1-2H3;;/q-2;;.
What are the key properties of N-but-2-en-2-ylmethanimine;uranium;vanadium?
N-but-2-en-2-ylmethanimine;uranium;vanadium has a molecular weight of 370.09 g/mol, XLogP of 1.29, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-but-2-en-2-ylmethanimine;uranium;vanadium is sourced from PubChem (CID 59967511), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).