C9H17P2Zr — CID 22949996
3,4-dimethylhexa-2,4-diene;phosphanylmethylphosphane;zirconium(3+) (PubChem CID 22949996) has the molecular formula C9H17P2Zr and a molecular weight of 278.41 g/mol. Its IUPAC name is 3,4-dimethylhexa-2,4-diene;phosphanylmethylphosphane;zirconium(3+).
| Compound Name | 3,4-dimethylhexa-2,4-diene;phosphanylmethylphosphane;zirconium(3+) |
|---|---|
| PubChem CID | 22949996 |
| Molecular Formula | C9H17P2Zr |
| Molecular Weight | 278.41 g/mol |
| Exact Mass | 276.99 |
| IUPAC Name | 3,4-dimethylhexa-2,4-diene;phosphanylmethylphosphane;zirconium(3+) |
| SMILES | C/[C-]=C(C)/C(C)=[C-]/C.P[CH-]P.[Zr+3] |
| InChI | InChI=1S/C8H12.CH5P2.Zr/c1-5-7(3)8(4)6-2;2-1-3;/h1-4H3;1H,2-3H2;/q-2;-1;+3 |
| InChIKey | OVPOBUVPGCEWCF-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.41 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|