About 3-ethylidene-2,5-dimethylhex-4-en-2-ol;rhodium;rutherfordium
3-ethylidene-2,5-dimethylhex-4-en-2-ol;rhodium;rutherfordium (PubChem CID 59990273) has the molecular formula C10H16ORfRh-2
and a molecular weight of 522.14 g/mol. Its IUPAC name is 3-ethylidene-2,5-dimethylhex-4-en-2-ol;rhodium;rutherfordium.
Molecular Properties
| Compound Name | 3-ethylidene-2,5-dimethylhex-4-en-2-ol;rhodium;rutherfordium |
| PubChem CID | 59990273 |
| Molecular Formula | C10H16ORfRh-2 |
| Molecular Weight | 522.14 g/mol |
| Exact Mass | 522.15 |
| IUPAC Name | 3-ethylidene-2,5-dimethylhex-4-en-2-ol;rhodium;rutherfordium |
| SMILES | C/[C-]=C(/[C-]=C(C)C)C(C)(C)O.[Rf].[Rh] |
| InChI | InChI=1S/C10H16O.Rf.Rh/c1-6-9(7-8(2)3)10(4,5)11;;/h11H,1-5H3;;/q-2;; |
| InChIKey | QAUSUGSZGZANIQ-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 522.14 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 3-ethylidene-2,5-dimethylhex-4-en-2-ol;rhodium;rutherfordium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethylidene-2,5-dimethylhex-4-en-2-ol;rhodium;rutherfordium?
The IUPAC name of 3-ethylidene-2,5-dimethylhex-4-en-2-ol;rhodium;rutherfordium (CID 59990273) is 3-ethylidene-2,5-dimethylhex-4-en-2-ol;rhodium;rutherfordium.
What is the SMILES notation for 3-ethylidene-2,5-dimethylhex-4-en-2-ol;rhodium;rutherfordium?
The canonical SMILES for 3-ethylidene-2,5-dimethylhex-4-en-2-ol;rhodium;rutherfordium is C/[C-]=C(/[C-]=C(C)C)C(C)(C)O.[Rf].[Rh].
What is the InChIKey of 3-ethylidene-2,5-dimethylhex-4-en-2-ol;rhodium;rutherfordium?
The InChIKey is QAUSUGSZGZANIQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16O.Rf.Rh/c1-6-9(7-8(2)3)10(4,5)11;;/h11H,1-5H3;;/q-2;;.
What are the key properties of 3-ethylidene-2,5-dimethylhex-4-en-2-ol;rhodium;rutherfordium?
3-ethylidene-2,5-dimethylhex-4-en-2-ol;rhodium;rutherfordium has a molecular weight of 522.14 g/mol, XLogP of 2.27, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethylidene-2,5-dimethylhex-4-en-2-ol;rhodium;rutherfordium is sourced from PubChem (CID 59990273), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).