C10H16ORfRh-2 — CID 59990299
rhodium;rutherfordium;2,3,3-trimethylhepta-4,5-dien-2-ol (PubChem CID 59990299) has the molecular formula C10H16ORfRh-2 and a molecular weight of 522.14 g/mol. Its IUPAC name is rhodium;rutherfordium;2,3,3-trimethylhepta-4,5-dien-2-ol.
| Compound Name | rhodium;rutherfordium;2,3,3-trimethylhepta-4,5-dien-2-ol |
|---|---|
| PubChem CID | 59990299 |
| Molecular Formula | C10H16ORfRh-2 |
| Molecular Weight | 522.14 g/mol |
| Exact Mass | 522.15 |
| IUPAC Name | rhodium;rutherfordium;2,3,3-trimethylhepta-4,5-dien-2-ol |
| SMILES | C[C-]=C=[C-]C(C)(C)C(C)(C)O.[Rf].[Rh] |
| InChI | InChI=1S/C10H16O.Rf.Rh/c1-6-7-8-9(2,3)10(4,5)11;;/h11H,1-5H3;;/q-2;; |
| InChIKey | PSNSADBQYWQZFH-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.14 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|