C12H31BO7 — CID 87113671
boric acid;bis(2,3-dimethylbutane-2,3-diol) (PubChem CID 87113671) has the molecular formula C12H31BO7 and a molecular weight of 298.19 g/mol. Its IUPAC name is boric acid;bis(2,3-dimethylbutane-2,3-diol).
| Compound Name | boric acid;bis(2,3-dimethylbutane-2,3-diol) |
|---|---|
| PubChem CID | 87113671 |
| Molecular Formula | C12H31BO7 |
| Molecular Weight | 298.19 g/mol |
| Exact Mass | 298.22 |
| IUPAC Name | boric acid;bis(2,3-dimethylbutane-2,3-diol) |
| SMILES | CC(C)(O)C(C)(C)O.CC(C)(O)C(C)(C)O.OB(O)O |
| InChI | InChI=1S/2C6H14O2.BH3O3/c2*1-5(2,7)6(3,4)8;2-1(3)4/h2*7-8H,1-4H3;2-4H |
| InChIKey | SGCLBIRCSTXTIU-UHFFFAOYSA-N |
| XLogP | -1.00 |
| TPSA | 141.61 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.19 |
| LogP ≤ 5 | -1.00 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|