C14H35BO7 — CID 158108058
boric acid;bis(2,4-dimethylpentane-2,4-diol) (PubChem CID 158108058) has the molecular formula C14H35BO7 and a molecular weight of 326.24 g/mol. Its IUPAC name is boric acid;bis(2,4-dimethylpentane-2,4-diol).
| Compound Name | boric acid;bis(2,4-dimethylpentane-2,4-diol) |
|---|---|
| PubChem CID | 158108058 |
| Molecular Formula | C14H35BO7 |
| Molecular Weight | 326.24 g/mol |
| Exact Mass | 326.25 |
| IUPAC Name | boric acid;bis(2,4-dimethylpentane-2,4-diol) |
| SMILES | CC(C)(O)CC(C)(C)O.CC(C)(O)CC(C)(C)O.OB(O)O |
| InChI | InChI=1S/2C7H16O2.BH3O3/c2*1-6(2,8)5-7(3,4)9;2-1(3)4/h2*8-9H,5H2,1-4H3;2-4H |
| InChIKey | FQBRXXBMYKCMBZ-UHFFFAOYSA-N |
| XLogP | -0.22 |
| TPSA | 141.61 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.24 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|