C14H27BO5 — CID 158144841
boric acid;2,3-dimethylbutane-2,3-diol;1,3-xylene (PubChem CID 158144841) has the molecular formula C14H27BO5 and a molecular weight of 286.18 g/mol. Its IUPAC name is boric acid;2,3-dimethylbutane-2,3-diol;1,3-xylene.
| Compound Name | boric acid;2,3-dimethylbutane-2,3-diol;1,3-xylene |
|---|---|
| PubChem CID | 158144841 |
| Molecular Formula | C14H27BO5 |
| Molecular Weight | 286.18 g/mol |
| Exact Mass | 286.20 |
| IUPAC Name | boric acid;2,3-dimethylbutane-2,3-diol;1,3-xylene |
| SMILES | CC(C)(O)C(C)(C)O.Cc1cccc(C)c1.OB(O)O |
| InChI | InChI=1S/C8H10.C6H14O2.BH3O3/c1-7-4-3-5-8(2)6-7;1-5(2,7)6(3,4)8;2-1(3)4/h3-6H,1-2H3;7-8H,1-4H3;2-4H |
| InChIKey | FUJRFZKAWFSUHL-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 101.15 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.18 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|