About 2,3-dimethylbutane-2,3-diol;2-methylpropoxyboronic acid
2,3-dimethylbutane-2,3-diol;2-methylpropoxyboronic acid (PubChem CID 175349270) has the molecular formula C10H25BO5
and a molecular weight of 236.12 g/mol. Its IUPAC name is 2,3-dimethylbutane-2,3-diol;2-methylpropoxyboronic acid.
Molecular Properties
| Compound Name | 2,3-dimethylbutane-2,3-diol;2-methylpropoxyboronic acid |
| PubChem CID | 175349270 |
| Molecular Formula | C10H25BO5 |
| Molecular Weight | 236.12 g/mol |
| Exact Mass | 236.18 |
| IUPAC Name | 2,3-dimethylbutane-2,3-diol;2-methylpropoxyboronic acid |
| SMILES | CC(C)(O)C(C)(C)O.CC(C)COB(O)O |
| InChI | InChI=1S/C6H14O2.C4H11BO3/c1-5(2,7)6(3,4)8;1-4(2)3-8-5(6)7/h7-8H,1-4H3;4,6-7H,3H2,1-2H3 |
| InChIKey | PSMMWBKXDUPUPB-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 90.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.12 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 2,3-dimethylbutane-2,3-diol;2-methylpropoxyboronic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-dimethylbutane-2,3-diol;2-methylpropoxyboronic acid?
The IUPAC name of 2,3-dimethylbutane-2,3-diol;2-methylpropoxyboronic acid (CID 175349270) is 2,3-dimethylbutane-2,3-diol;2-methylpropoxyboronic acid.
What is the SMILES notation for 2,3-dimethylbutane-2,3-diol;2-methylpropoxyboronic acid?
The canonical SMILES for 2,3-dimethylbutane-2,3-diol;2-methylpropoxyboronic acid is CC(C)(O)C(C)(C)O.CC(C)COB(O)O.
What is the InChIKey of 2,3-dimethylbutane-2,3-diol;2-methylpropoxyboronic acid?
The InChIKey is PSMMWBKXDUPUPB-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H14O2.C4H11BO3/c1-5(2,7)6(3,4)8;1-4(2)3-8-5(6)7/h7-8H,1-4H3;4,6-7H,3H2,1-2H3.
What are the key properties of 2,3-dimethylbutane-2,3-diol;2-methylpropoxyboronic acid?
2,3-dimethylbutane-2,3-diol;2-methylpropoxyboronic acid has a molecular weight of 236.12 g/mol, XLogP of 0.16, 4 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dimethylbutane-2,3-diol;2-methylpropoxyboronic acid is sourced from PubChem (CID 175349270), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).