C11H29BClNO5 — CID 175020502
3-(1-amino-3-methylbutoxy)-2,3-dimethylbutan-2-ol;boric acid;hydrochloride (PubChem CID 175020502) has the molecular formula C11H29BClNO5 and a molecular weight of 301.62 g/mol. Its IUPAC name is 3-(1-amino-3-methylbutoxy)-2,3-dimethylbutan-2-ol;boric acid;hydrochloride.
| Compound Name | 3-(1-amino-3-methylbutoxy)-2,3-dimethylbutan-2-ol;boric acid;hydrochloride |
|---|---|
| PubChem CID | 175020502 |
| Molecular Formula | C11H29BClNO5 |
| Molecular Weight | 301.62 g/mol |
| Exact Mass | 301.18 |
| IUPAC Name | 3-(1-amino-3-methylbutoxy)-2,3-dimethylbutan-2-ol;boric acid;hydrochloride |
| SMILES | CC(C)CC(N)OC(C)(C)C(C)(C)O.Cl.OB(O)O |
| InChI | InChI=1S/C11H25NO2.BH3O3.ClH/c1-8(2)7-9(12)14-11(5,6)10(3,4)13;2-1(3)4;/h8-9,13H,7,12H2,1-6H3;2-4H;1H |
| InChIKey | OPJBELUEFYUZDE-UHFFFAOYSA-N |
| XLogP | 0.25 |
| TPSA | 116.17 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.62 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|