C14H31NO — CID 54045200
(4S)-4-amino-3-tert-butyl-2,2,6-trimethylheptan-3-ol (PubChem CID 54045200) has the molecular formula C14H31NO and a molecular weight of 229.41 g/mol. Its IUPAC name is (4S)-4-amino-3-tert-butyl-2,2,6-trimethylheptan-3-ol.
| Compound Name | (4S)-4-amino-3-tert-butyl-2,2,6-trimethylheptan-3-ol |
|---|---|
| PubChem CID | 54045200 |
| Molecular Formula | C14H31NO |
| Molecular Weight | 229.41 g/mol |
| Exact Mass | 229.24 |
| IUPAC Name | (4S)-4-amino-3-tert-butyl-2,2,6-trimethylheptan-3-ol |
| SMILES | CC(C)C[C@H](N)C(O)(C(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C14H31NO/c1-10(2)9-11(15)14(16,12(3,4)5)13(6,7)8/h10-11,16H,9,15H2,1-8H3/t11-/m0/s1 |
| InChIKey | LPBKURKFEDXNRB-NSHDSACASA-N |
| XLogP | 3.18 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.41 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |