C16H34O — CID 134857682
2,4,6,8,10-pentamethylundecan-6-ol (PubChem CID 134857682) has the molecular formula C16H34O and a molecular weight of 242.45 g/mol. Its IUPAC name is 2,4,6,8,10-pentamethylundecan-6-ol.
| Compound Name | 2,4,6,8,10-pentamethylundecan-6-ol |
|---|---|
| PubChem CID | 134857682 |
| Molecular Formula | C16H34O |
| Molecular Weight | 242.45 g/mol |
| Exact Mass | 242.26 |
| IUPAC Name | 2,4,6,8,10-pentamethylundecan-6-ol |
| SMILES | CC(C)CC(C)CC(C)(O)CC(C)CC(C)C |
| InChI | InChI=1S/C16H34O/c1-12(2)8-14(5)10-16(7,17)11-15(6)9-13(3)4/h12-15,17H,8-11H2,1-7H3 |
| InChIKey | MLJSGPVKFVOBNM-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.45 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |