C16H34O2 — CID 178133333
(2S)-2-ethyl-2,4,6-trimethylheptanoic acid;2-methylpropane (PubChem CID 178133333) has the molecular formula C16H34O2 and a molecular weight of 258.45 g/mol. Its IUPAC name is (2S)-2-ethyl-2,4,6-trimethylheptanoic acid;2-methylpropane.
| Compound Name | (2S)-2-ethyl-2,4,6-trimethylheptanoic acid;2-methylpropane |
|---|---|
| PubChem CID | 178133333 |
| Molecular Formula | C16H34O2 |
| Molecular Weight | 258.45 g/mol |
| Exact Mass | 258.26 |
| IUPAC Name | (2S)-2-ethyl-2,4,6-trimethylheptanoic acid;2-methylpropane |
| SMILES | CC(C)C.CC[C@@](C)(CC(C)CC(C)C)C(=O)O |
| InChI | InChI=1S/C12H24O2.C4H10/c1-6-12(5,11(13)14)8-10(4)7-9(2)3;1-4(2)3/h9-10H,6-8H2,1-5H3,(H,13,14);4H,1-3H3/t10?,12-;/m0./s1 |
| InChIKey | FBWSFSSOWNZISR-RLVDVTLISA-N |
| XLogP | 5.22 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.45 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |