C16H33NO2 — CID 107871175
2-[[bis(3-methylbutyl)amino]methyl]-2-methylbutanoic acid (PubChem CID 107871175) has the molecular formula C16H33NO2 and a molecular weight of 271.44 g/mol. Its IUPAC name is 2-[[bis(3-methylbutyl)amino]methyl]-2-methylbutanoic acid.
| Compound Name | 2-[[bis(3-methylbutyl)amino]methyl]-2-methylbutanoic acid |
|---|---|
| PubChem CID | 107871175 |
| Molecular Formula | C16H33NO2 |
| Molecular Weight | 271.44 g/mol |
| Exact Mass | 271.25 |
| IUPAC Name | 2-[[bis(3-methylbutyl)amino]methyl]-2-methylbutanoic acid |
| SMILES | CCC(C)(CN(CCC(C)C)CCC(C)C)C(=O)O |
| InChI | InChI=1S/C16H33NO2/c1-7-16(6,15(18)19)12-17(10-8-13(2)3)11-9-14(4)5/h13-14H,7-12H2,1-6H3,(H,18,19) |
| InChIKey | NOABIUWKRFITOV-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.44 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |