C15H32O2 — CID 155249648
2,3,3,4,4,5,5,6-octamethylheptane-2,6-diol (PubChem CID 155249648) has the molecular formula C15H32O2 and a molecular weight of 244.42 g/mol. Its IUPAC name is 2,3,3,4,4,5,5,6-octamethylheptane-2,6-diol.
| Compound Name | 2,3,3,4,4,5,5,6-octamethylheptane-2,6-diol |
|---|---|
| PubChem CID | 155249648 |
| Molecular Formula | C15H32O2 |
| Molecular Weight | 244.42 g/mol |
| Exact Mass | 244.24 |
| IUPAC Name | 2,3,3,4,4,5,5,6-octamethylheptane-2,6-diol |
| SMILES | CC(C)(O)C(C)(C)C(C)(C)C(C)(C)C(C)(C)O |
| InChI | InChI=1S/C15H32O2/c1-11(2,12(3,4)14(7,8)16)13(5,6)15(9,10)17/h16-17H,1-10H3 |
| InChIKey | RLFCTQLFLPIOGI-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.42 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |