About copper(1+);ethanone;propan-2-one
copper(1+);ethanone;propan-2-one (PubChem CID 87381643) has the molecular formula C5H9CuO2
and a molecular weight of 164.67 g/mol. Its IUPAC name is copper(1+);ethanone;propan-2-one.
Molecular Properties
| Compound Name | copper(1+);ethanone;propan-2-one |
| PubChem CID | 87381643 |
| Molecular Formula | C5H9CuO2 |
| Molecular Weight | 164.67 g/mol |
| Exact Mass | 163.99 |
| IUPAC Name | copper(1+);ethanone;propan-2-one |
| SMILES | CC(C)=O.C[C-]=O.[Cu+] |
| InChI | InChI=1S/C3H6O.C2H3O.Cu/c1-3(2)4;1-2-3;/h1-2H3;1H3;/q;-1;+1 |
| InChIKey | FHUMETILKBTMEK-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.67 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze copper(1+);ethanone;propan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of copper(1+);ethanone;propan-2-one?
The IUPAC name of copper(1+);ethanone;propan-2-one (CID 87381643) is copper(1+);ethanone;propan-2-one.
What is the SMILES notation for copper(1+);ethanone;propan-2-one?
The canonical SMILES for copper(1+);ethanone;propan-2-one is CC(C)=O.C[C-]=O.[Cu+].
What is the InChIKey of copper(1+);ethanone;propan-2-one?
The InChIKey is FHUMETILKBTMEK-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H6O.C2H3O.Cu/c1-3(2)4;1-2-3;/h1-2H3;1H3;/q;-1;+1.
What are the key properties of copper(1+);ethanone;propan-2-one?
copper(1+);ethanone;propan-2-one has a molecular weight of 164.67 g/mol, XLogP of 0.71, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for copper(1+);ethanone;propan-2-one is sourced from PubChem (CID 87381643), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).