C8H9Cl2W- — CID 59938659
[(3E)-3,5-dichloro-4-methylhepta-3,5-dien-2-ylidene]tungsten (PubChem CID 59938659) has the molecular formula C8H9Cl2W- and a molecular weight of 359.91 g/mol. Its IUPAC name is [(3E)-3,5-dichloro-4-methylhepta-3,5-dien-2-ylidene]tungsten.
| Compound Name | [(3E)-3,5-dichloro-4-methylhepta-3,5-dien-2-ylidene]tungsten |
|---|---|
| PubChem CID | 59938659 |
| Molecular Formula | C8H9Cl2W- |
| Molecular Weight | 359.91 g/mol |
| Exact Mass | 358.96 |
| IUPAC Name | [(3E)-3,5-dichloro-4-methylhepta-3,5-dien-2-ylidene]tungsten |
| SMILES | C/[C-]=C(Cl)/C(C)=C(/Cl)C(C)=[W] |
| InChI | InChI=1S/C8H9Cl2.W/c1-4-7(9)6(3)8(10)5-2;/h1-3H3;/q-1;/b7-6+; |
| InChIKey | ITHFHVKEBHYEFV-UHDJGPCESA-N |
| XLogP | 3.18 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.91 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|