C7H10NO3- — CID 117274197
N-[(4-methyl-2,6,7-trioxabicyclo[2.2.1]heptan-1-yl)methyl]methanimine (PubChem CID 117274197) has the molecular formula C7H10NO3- and a molecular weight of 156.16 g/mol. Its IUPAC name is N-[(4-methyl-2,6,7-trioxabicyclo[2.2.1]heptan-1-yl)methyl]methanimine.
| Compound Name | N-[(4-methyl-2,6,7-trioxabicyclo[2.2.1]heptan-1-yl)methyl]methanimine |
|---|---|
| PubChem CID | 117274197 |
| Molecular Formula | C7H10NO3- |
| Molecular Weight | 156.16 g/mol |
| Exact Mass | 156.07 |
| IUPAC Name | N-[(4-methyl-2,6,7-trioxabicyclo[2.2.1]heptan-1-yl)methyl]methanimine |
| SMILES | [H]/[C-]=N/CC12OCC(C)(CO1)O2 |
| InChI | InChI=1S/C7H10NO3/c1-6-4-9-7(11-6,3-8-2)10-5-6/h2H,3-5H2,1H3/q-1 |
| InChIKey | RYMCRLOPLAJQMK-UHFFFAOYSA-N |
| XLogP | 0.05 |
| TPSA | 40.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.16 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|