About propan-2-ylideneazanide;yttrium
propan-2-ylideneazanide;yttrium (PubChem CID 59954797) has the molecular formula C3H6NY-
and a molecular weight of 144.99 g/mol. Its IUPAC name is propan-2-ylideneazanide;yttrium.
Molecular Properties
| Compound Name | propan-2-ylideneazanide;yttrium |
| PubChem CID | 59954797 |
| Molecular Formula | C3H6NY- |
| Molecular Weight | 144.99 g/mol |
| Exact Mass | 144.96 |
| IUPAC Name | propan-2-ylideneazanide;yttrium |
| SMILES | CC(C)=[N-].[Y] |
| InChI | InChI=1S/C3H6N.Y/c1-3(2)4;/h1-2H3;/q-1; |
| InChIKey | BIENGWTYEGFRDZ-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 22.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 5 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 144.99 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze propan-2-ylideneazanide;yttrium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propan-2-ylideneazanide;yttrium?
The IUPAC name of propan-2-ylideneazanide;yttrium (CID 59954797) is propan-2-ylideneazanide;yttrium.
What is the SMILES notation for propan-2-ylideneazanide;yttrium?
The canonical SMILES for propan-2-ylideneazanide;yttrium is CC(C)=[N-].[Y].
What is the InChIKey of propan-2-ylideneazanide;yttrium?
The InChIKey is BIENGWTYEGFRDZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H6N.Y/c1-3(2)4;/h1-2H3;/q-1;.
What are the key properties of propan-2-ylideneazanide;yttrium?
propan-2-ylideneazanide;yttrium has a molecular weight of 144.99 g/mol, XLogP of 1.03, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for propan-2-ylideneazanide;yttrium is sourced from PubChem (CID 59954797), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).