About but-1-ene;2-methylpropane;yttrium
but-1-ene;2-methylpropane;yttrium (PubChem CID 178013549) has the molecular formula C8H16Y-2
and a molecular weight of 201.12 g/mol. Its IUPAC name is but-1-ene;2-methylpropane;yttrium.
Molecular Properties
| Compound Name | but-1-ene;2-methylpropane;yttrium |
| PubChem CID | 178013549 |
| Molecular Formula | C8H16Y-2 |
| Molecular Weight | 201.12 g/mol |
| Exact Mass | 201.03 |
| IUPAC Name | but-1-ene;2-methylpropane;yttrium |
| SMILES | CC(C)C.[H]/[C-]=C/C[CH2-].[Y] |
| InChI | InChI=1S/C4H10.C4H6.Y/c1-4(2)3;1-3-4-2;/h4H,1-3H3;1,3H,2,4H2;/q;-2; |
| InChIKey | LHSQTYZPFFIEPS-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.12 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze but-1-ene;2-methylpropane;yttrium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of but-1-ene;2-methylpropane;yttrium?
The IUPAC name of but-1-ene;2-methylpropane;yttrium (CID 178013549) is but-1-ene;2-methylpropane;yttrium.
What is the SMILES notation for but-1-ene;2-methylpropane;yttrium?
The canonical SMILES for but-1-ene;2-methylpropane;yttrium is CC(C)C.[H]/[C-]=C/C[CH2-].[Y].
What is the InChIKey of but-1-ene;2-methylpropane;yttrium?
The InChIKey is LHSQTYZPFFIEPS-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H10.C4H6.Y/c1-4(2)3;1-3-4-2;/h4H,1-3H3;1,3H,2,4H2;/q;-2;.
What are the key properties of but-1-ene;2-methylpropane;yttrium?
but-1-ene;2-methylpropane;yttrium has a molecular weight of 201.12 g/mol, XLogP of 2.86, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for but-1-ene;2-methylpropane;yttrium is sourced from PubChem (CID 178013549), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).