About 2-methylpropanedithioate
2-methylpropanedithioate (PubChem CID 19087069) has the molecular formula C4H7S2-
and a molecular weight of 119.23 g/mol. Its IUPAC name is 2-methylpropanedithioate.
Molecular Properties
| Compound Name | 2-methylpropanedithioate |
| PubChem CID | 19087069 |
| Molecular Formula | C4H7S2- |
| Molecular Weight | 119.23 g/mol |
| Exact Mass | 119.00 |
| IUPAC Name | 2-methylpropanedithioate |
| SMILES | CC(C)C(=S)[S-] |
| InChI | InChI=1S/C4H8S2/c1-3(2)4(5)6/h3H,1-2H3,(H,5,6)/p-1 |
| InChIKey | OAZPGUICIFMRKI-UHFFFAOYSA-M |
| XLogP | 1.52 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 119.23 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|
Analyze 2-methylpropanedithioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylpropanedithioate?
The IUPAC name of 2-methylpropanedithioate (CID 19087069) is 2-methylpropanedithioate.
What is the SMILES notation for 2-methylpropanedithioate?
The canonical SMILES for 2-methylpropanedithioate is CC(C)C(=S)[S-].
What is the InChIKey of 2-methylpropanedithioate?
The InChIKey is OAZPGUICIFMRKI-UHFFFAOYSA-M. The full InChI is InChI=1S/C4H8S2/c1-3(2)4(5)6/h3H,1-2H3,(H,5,6)/p-1.
What are the key properties of 2-methylpropanedithioate?
2-methylpropanedithioate has a molecular weight of 119.23 g/mol, XLogP of 1.52, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylpropanedithioate is sourced from PubChem (CID 19087069), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).