About lanthanum;propane;propan-2-ol
lanthanum;propane;propan-2-ol (PubChem CID 148548926) has the molecular formula C6H15LaO-
and a molecular weight of 242.09 g/mol. Its IUPAC name is lanthanum;propane;propan-2-ol.
Molecular Properties
| Compound Name | lanthanum;propane;propan-2-ol |
| PubChem CID | 148548926 |
| Molecular Formula | C6H15LaO- |
| Molecular Weight | 242.09 g/mol |
| Exact Mass | 242.02 |
| IUPAC Name | lanthanum;propane;propan-2-ol |
| SMILES | CC(C)O.C[CH-]C.[La] |
| InChI | InChI=1S/C3H8O.C3H7.La/c1-3(2)4;1-3-2;/h3-4H,1-2H3;3H,1-2H3;/q;-1; |
| InChIKey | YRPOALADYYHICE-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.09 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze lanthanum;propane;propan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of lanthanum;propane;propan-2-ol?
The IUPAC name of lanthanum;propane;propan-2-ol (CID 148548926) is lanthanum;propane;propan-2-ol.
What is the SMILES notation for lanthanum;propane;propan-2-ol?
The canonical SMILES for lanthanum;propane;propan-2-ol is CC(C)O.C[CH-]C.[La].
What is the InChIKey of lanthanum;propane;propan-2-ol?
The InChIKey is YRPOALADYYHICE-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H8O.C3H7.La/c1-3(2)4;1-3-2;/h3-4H,1-2H3;3H,1-2H3;/q;-1;.
What are the key properties of lanthanum;propane;propan-2-ol?
lanthanum;propane;propan-2-ol has a molecular weight of 242.09 g/mol, XLogP of 1.62, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for lanthanum;propane;propan-2-ol is sourced from PubChem (CID 148548926), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).