About ethylidenetungsten;1-(methylamino)prop-2-enylidenetungsten
ethylidenetungsten;1-(methylamino)prop-2-enylidenetungsten (PubChem CID 59665904) has the molecular formula C6H9NW2-2
and a molecular weight of 462.83 g/mol. Its IUPAC name is ethylidenetungsten;1-(methylamino)prop-2-enylidenetungsten.
Molecular Properties
| Compound Name | ethylidenetungsten;1-(methylamino)prop-2-enylidenetungsten |
| PubChem CID | 59665904 |
| Molecular Formula | C6H9NW2-2 |
| Molecular Weight | 462.83 g/mol |
| Exact Mass | 462.98 |
| IUPAC Name | ethylidenetungsten;1-(methylamino)prop-2-enylidenetungsten |
| SMILES | C[C-]=[W].[H]/[C-]=C/C(=[W])NC |
| InChI | InChI=1S/C4H6N.C2H3.2W/c1-3-4-5-2;1-2;;/h1,3,5H,2H3;1H3;;/q2*-1;; |
| InChIKey | IOFJBDOQCOSCBH-UHFFFAOYSA-N |
| XLogP | 0.10 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 462.83 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze ethylidenetungsten;1-(methylamino)prop-2-enylidenetungsten with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethylidenetungsten;1-(methylamino)prop-2-enylidenetungsten?
The IUPAC name of ethylidenetungsten;1-(methylamino)prop-2-enylidenetungsten (CID 59665904) is ethylidenetungsten;1-(methylamino)prop-2-enylidenetungsten.
What is the SMILES notation for ethylidenetungsten;1-(methylamino)prop-2-enylidenetungsten?
The canonical SMILES for ethylidenetungsten;1-(methylamino)prop-2-enylidenetungsten is C[C-]=[W].[H]/[C-]=C/C(=[W])NC.
What is the InChIKey of ethylidenetungsten;1-(methylamino)prop-2-enylidenetungsten?
The InChIKey is IOFJBDOQCOSCBH-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H6N.C2H3.2W/c1-3-4-5-2;1-2;;/h1,3,5H,2H3;1H3;;/q2*-1;;.
What are the key properties of ethylidenetungsten;1-(methylamino)prop-2-enylidenetungsten?
ethylidenetungsten;1-(methylamino)prop-2-enylidenetungsten has a molecular weight of 462.83 g/mol, XLogP of 0.10, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethylidenetungsten;1-(methylamino)prop-2-enylidenetungsten is sourced from PubChem (CID 59665904), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).