About aminomethylidenetungsten;1-ethoxyprop-2-enylidenetungsten
aminomethylidenetungsten;1-ethoxyprop-2-enylidenetungsten (PubChem CID 59737785) has the molecular formula C6H9NOW2-2
and a molecular weight of 478.82 g/mol. Its IUPAC name is aminomethylidenetungsten;1-ethoxyprop-2-enylidenetungsten.
Molecular Properties
| Compound Name | aminomethylidenetungsten;1-ethoxyprop-2-enylidenetungsten |
| PubChem CID | 59737785 |
| Molecular Formula | C6H9NOW2-2 |
| Molecular Weight | 478.82 g/mol |
| Exact Mass | 478.97 |
| IUPAC Name | aminomethylidenetungsten;1-ethoxyprop-2-enylidenetungsten |
| SMILES | N[C-]=[W].[H]/[C-]=C/C(=[W])OCC |
| InChI | InChI=1S/C5H7O.CH2N.2W/c1-3-5-6-4-2;1-2;;/h1,3H,4H2,2H3;2H2;;/q2*-1;; |
| InChIKey | MNEJVPOMJYOIJU-UHFFFAOYSA-N |
| XLogP | -0.18 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 478.82 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'} |
|---|
Analyze aminomethylidenetungsten;1-ethoxyprop-2-enylidenetungsten with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of aminomethylidenetungsten;1-ethoxyprop-2-enylidenetungsten?
The IUPAC name of aminomethylidenetungsten;1-ethoxyprop-2-enylidenetungsten (CID 59737785) is aminomethylidenetungsten;1-ethoxyprop-2-enylidenetungsten.
What is the SMILES notation for aminomethylidenetungsten;1-ethoxyprop-2-enylidenetungsten?
The canonical SMILES for aminomethylidenetungsten;1-ethoxyprop-2-enylidenetungsten is N[C-]=[W].[H]/[C-]=C/C(=[W])OCC.
What is the InChIKey of aminomethylidenetungsten;1-ethoxyprop-2-enylidenetungsten?
The InChIKey is MNEJVPOMJYOIJU-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H7O.CH2N.2W/c1-3-5-6-4-2;1-2;;/h1,3H,4H2,2H3;2H2;;/q2*-1;;.
What are the key properties of aminomethylidenetungsten;1-ethoxyprop-2-enylidenetungsten?
aminomethylidenetungsten;1-ethoxyprop-2-enylidenetungsten has a molecular weight of 478.82 g/mol, XLogP of -0.18, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for aminomethylidenetungsten;1-ethoxyprop-2-enylidenetungsten is sourced from PubChem (CID 59737785), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).