C22H35NO — CID 144527836
(3Z,5Z)-5-tert-butyl-3-(N,4-dimethylanilino)octa-3,5-dien-2-one;ethane (PubChem CID 144527836) has the molecular formula C22H35NO and a molecular weight of 329.53 g/mol. Its IUPAC name is (3Z,5Z)-5-tert-butyl-3-(N,4-dimethylanilino)octa-3,5-dien-2-one;ethane.
| Compound Name | (3Z,5Z)-5-tert-butyl-3-(N,4-dimethylanilino)octa-3,5-dien-2-one;ethane |
|---|---|
| PubChem CID | 144527836 |
| Molecular Formula | C22H35NO |
| Molecular Weight | 329.53 g/mol |
| Exact Mass | 329.27 |
| IUPAC Name | (3Z,5Z)-5-tert-butyl-3-(N,4-dimethylanilino)octa-3,5-dien-2-one;ethane |
| SMILES | CC.CC/C=C(/C=C(/C(C)=O)N(C)c1ccc(C)cc1)C(C)(C)C |
| InChI | InChI=1S/C20H29NO.C2H6/c1-8-9-17(20(4,5)6)14-19(16(3)22)21(7)18-12-10-15(2)11-13-18;1-2/h9-14H,8H2,1-7H3;1-2H3/b17-9-,19-14-; |
| InChIKey | UJLNSIRNPIDVFZ-VTJOWZKMSA-N |
| XLogP | 6.31 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.53 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|