C26H36FNO — CID 143451902
ethane;(E,3E)-3-[(4-fluoro-N-methylanilino)methylidene]-4-(4-methylphenyl)hept-4-en-2-one (PubChem CID 143451902) has the molecular formula C26H36FNO and a molecular weight of 397.58 g/mol. Its IUPAC name is ethane;(E,3E)-3-[(4-fluoro-N-methylanilino)methylidene]-4-(4-methylphenyl)hept-4-en-2-one.
| Compound Name | ethane;(E,3E)-3-[(4-fluoro-N-methylanilino)methylidene]-4-(4-methylphenyl)hept-4-en-2-one |
|---|---|
| PubChem CID | 143451902 |
| Molecular Formula | C26H36FNO |
| Molecular Weight | 397.58 g/mol |
| Exact Mass | 397.28 |
| IUPAC Name | ethane;(E,3E)-3-[(4-fluoro-N-methylanilino)methylidene]-4-(4-methylphenyl)hept-4-en-2-one |
| SMILES | CC.CC.CC/C=C(C(=C\N(C)c1ccc(F)cc1)/C(C)=O)\c1ccc(C)cc1 |
| InChI | InChI=1S/C22H24FNO.2C2H6/c1-5-6-21(18-9-7-16(2)8-10-18)22(17(3)25)15-24(4)20-13-11-19(23)12-14-20;2*1-2/h6-15H,5H2,1-4H3;2*1-2H3/b21-6+,22-15-;; |
| InChIKey | AVTDUGNPTCQMEI-VALQQOSHSA-N |
| XLogP | 7.59 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.58 |
| LogP ≤ 5 | 7.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|