3,3-dimethyl-2-[methyl-(4-methylphenyl)carbamoyl]butanoic acid

C15H21NO3 — CID 116537045

IUPAC3,3-dimethyl-2-[methyl-(4-methylphenyl)carbamoyl]butanoic acid
SMILESCc1ccc(N(C)C(=O)C(C(=O)O)C(C)(C)C)cc1
InChIInChI=1S/C15H21NO3/c1-10-6-8-11(9-7-10)16(5)13(17)12(14(18)19)15(2,3)4/h6-9,12H,1-5H3,(H,18,19)
InChIKeyBBQRZHPTQYDDKC-UHFFFAOYSA-N
MW263.34 g/mol
LogP2.70
Rot. Bonds3

About 3,3-dimethyl-2-[methyl-(4-methylphenyl)carbamoyl]butanoic acid

3,3-dimethyl-2-[methyl-(4-methylphenyl)carbamoyl]butanoic acid (PubChem CID 116537045) has the molecular formula C15H21NO3 and a molecular weight of 263.34 g/mol. Its IUPAC name is 3,3-dimethyl-2-[methyl-(4-methylphenyl)carbamoyl]butanoic acid.

Molecular Properties

Compound Name3,3-dimethyl-2-[methyl-(4-methylphenyl)carbamoyl]butanoic acid
PubChem CID116537045
Molecular FormulaC15H21NO3
Molecular Weight263.34 g/mol
Exact Mass263.15
IUPAC Name3,3-dimethyl-2-[methyl-(4-methylphenyl)carbamoyl]butanoic acid
SMILESCc1ccc(N(C)C(=O)C(C(=O)O)C(C)(C)C)cc1
InChIInChI=1S/C15H21NO3/c1-10-6-8-11(9-7-10)16(5)13(17)12(14(18)19)15(2,3)4/h6-9,12H,1-5H3,(H,18,19)
InChIKeyBBQRZHPTQYDDKC-UHFFFAOYSA-N
XLogP2.70
TPSA57.61 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds3
Heavy Atoms19
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500263.34
LogP ≤ 52.70
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}

Analyze 3,3-dimethyl-2-[methyl-(4-methylphenyl)carbamoyl]butanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3,3-dimethyl-2-[methyl-(4-methylphenyl)carbamoyl]butanoic acid?
The IUPAC name of 3,3-dimethyl-2-[methyl-(4-methylphenyl)carbamoyl]butanoic acid (CID 116537045) is 3,3-dimethyl-2-[methyl-(4-methylphenyl)carbamoyl]butanoic acid.
What is the SMILES notation for 3,3-dimethyl-2-[methyl-(4-methylphenyl)carbamoyl]butanoic acid?
The canonical SMILES for 3,3-dimethyl-2-[methyl-(4-methylphenyl)carbamoyl]butanoic acid is Cc1ccc(N(C)C(=O)C(C(=O)O)C(C)(C)C)cc1.
What is the InChIKey of 3,3-dimethyl-2-[methyl-(4-methylphenyl)carbamoyl]butanoic acid?
The InChIKey is BBQRZHPTQYDDKC-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H21NO3/c1-10-6-8-11(9-7-10)16(5)13(17)12(14(18)19)15(2,3)4/h6-9,12H,1-5H3,(H,18,19).
What are the key properties of 3,3-dimethyl-2-[methyl-(4-methylphenyl)carbamoyl]butanoic acid?
3,3-dimethyl-2-[methyl-(4-methylphenyl)carbamoyl]butanoic acid has a molecular weight of 263.34 g/mol, XLogP of 2.70, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3,3-dimethyl-2-[methyl-(4-methylphenyl)carbamoyl]butanoic acid is sourced from PubChem (CID 116537045), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).