C42H49N7 — CID 118530732
2-(2-methylpropyl)-4,7-bis[4-[N-(2-methylpropyl)anilino]phenyl]benzotriazole-5,6-diamine (PubChem CID 118530732) has the molecular formula C42H49N7 and a molecular weight of 651.90 g/mol. Its IUPAC name is 2-(2-methylpropyl)-4,7-bis[4-[N-(2-methylpropyl)anilino]phenyl]benzotriazole-5,6-diamine.
| Compound Name | 2-(2-methylpropyl)-4,7-bis[4-[N-(2-methylpropyl)anilino]phenyl]benzotriazole-5,6-diamine |
|---|---|
| PubChem CID | 118530732 |
| Molecular Formula | C42H49N7 |
| Molecular Weight | 651.90 g/mol |
| Exact Mass | 651.40 |
| IUPAC Name | 2-(2-methylpropyl)-4,7-bis[4-[N-(2-methylpropyl)anilino]phenyl]benzotriazole-5,6-diamine |
| SMILES | CC(C)CN(c1ccccc1)c1ccc(-c2c(N)c(N)c(-c3ccc(N(CC(C)C)c4ccccc4)cc3)c3nn(CC(C)C)nc23)cc1 |
| InChI | InChI=1S/C42H49N7/c1-28(2)25-47(33-13-9-7-10-14-33)35-21-17-31(18-22-35)37-39(43)40(44)38(42-41(37)45-49(46-42)27-30(5)6)32-19-23-36(24-20-32)48(26-29(3)4)34-15-11-8-12-16-34/h7-24,28-30H,25-27,43-44H2,1-6H3 |
| InChIKey | MFQUXTAGIYWAAT-UHFFFAOYSA-N |
| XLogP | 10.17 |
| TPSA | 89.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 651.90 |
| LogP ≤ 5 | 10.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|