C58H62N8 — CID 140829073
4-[2,6-bis(2-ethylhexyl)-8-[4-(N-phenylanilino)phenyl]triazolo[4,5-f]benzotriazol-2-ium-3-id-4-yl]-N,N-diphenylaniline (PubChem CID 140829073) has the molecular formula C58H62N8 and a molecular weight of 871.19 g/mol. Its IUPAC name is 4-[2,6-bis(2-ethylhexyl)-8-[4-(N-phenylanilino)phenyl]triazolo[4,5-f]benzotriazol-2-ium-3-id-4-yl]-N,N-diphenylaniline.
| Compound Name | 4-[2,6-bis(2-ethylhexyl)-8-[4-(N-phenylanilino)phenyl]triazolo[4,5-f]benzotriazol-2-ium-3-id-4-yl]-N,N-diphenylaniline |
|---|---|
| PubChem CID | 140829073 |
| Molecular Formula | C58H62N8 |
| Molecular Weight | 871.19 g/mol |
| Exact Mass | 870.51 |
| IUPAC Name | 4-[2,6-bis(2-ethylhexyl)-8-[4-(N-phenylanilino)phenyl]triazolo[4,5-f]benzotriazol-2-ium-3-id-4-yl]-N,N-diphenylaniline |
| SMILES | CCCCC(CC)Cn1nc2c(-c3ccc(N(c4ccccc4)c4ccccc4)cc3)c3n[n+](CC(CC)CCCC)[n-]c3c(-c3ccc(N(c4ccccc4)c4ccccc4)cc3)c2n1 |
| InChI | InChI=1S/C58H62N8/c1-5-9-23-43(7-3)41-63-59-55-53(45-33-37-51(38-34-45)65(47-25-15-11-16-26-47)48-27-17-12-18-28-48)57-58(62-64(61-57)42-44(8-4)24-10-6-2)54(56(55)60-63)46-35-39-52(40-36-46)66(49-29-19-13-20-30-49)50-31-21-14-22-32-50/h11-22,25-40,43-44H,5-10,23-24,41-42H2,1-4H3 |
| InChIKey | KLLFVRXGWFGJPU-UHFFFAOYSA-N |
| XLogP | 14.93 |
| TPSA | 68.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 66 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 871.19 |
| LogP ≤ 5 | 14.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|