C48H41N7 — CID 134292107
4-[5,6-bis(methylideneamino)-2-(2-methylpropyl)-7-[4-(N-phenylanilino)phenyl]benzotriazol-4-yl]-N,N-diphenylaniline (PubChem CID 134292107) has the molecular formula C48H41N7 and a molecular weight of 715.91 g/mol. Its IUPAC name is 4-[5,6-bis(methylideneamino)-2-(2-methylpropyl)-7-[4-(N-phenylanilino)phenyl]benzotriazol-4-yl]-N,N-diphenylaniline.
| Compound Name | 4-[5,6-bis(methylideneamino)-2-(2-methylpropyl)-7-[4-(N-phenylanilino)phenyl]benzotriazol-4-yl]-N,N-diphenylaniline |
|---|---|
| PubChem CID | 134292107 |
| Molecular Formula | C48H41N7 |
| Molecular Weight | 715.91 g/mol |
| Exact Mass | 715.34 |
| IUPAC Name | 4-[5,6-bis(methylideneamino)-2-(2-methylpropyl)-7-[4-(N-phenylanilino)phenyl]benzotriazol-4-yl]-N,N-diphenylaniline |
| SMILES | C=Nc1c(N=C)c(-c2ccc(N(c3ccccc3)c3ccccc3)cc2)c2nn(CC(C)C)nc2c1-c1ccc(N(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C48H41N7/c1-34(2)33-53-51-47-43(35-25-29-41(30-26-35)54(37-17-9-5-10-18-37)38-19-11-6-12-20-38)45(49-3)46(50-4)44(48(47)52-53)36-27-31-42(32-28-36)55(39-21-13-7-14-22-39)40-23-15-8-16-24-40/h5-32,34H,3-4,33H2,1-2H3 |
| InChIKey | PTMGEHIQYMKCDE-UHFFFAOYSA-N |
| XLogP | 13.03 |
| TPSA | 61.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 715.91 |
| LogP ≤ 5 | 13.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|