C57H48N8O2 — CID 118534056
4,4-dimethyl-1-[4-[5-(methylamino)-6-(methylideneamino)-4,7-bis[4-(N-phenylanilino)phenyl]benzotriazol-2-yl]phenyl]piperidine-2,6-dione (PubChem CID 118534056) has the molecular formula C57H48N8O2 and a molecular weight of 877.07 g/mol. Its IUPAC name is 4,4-dimethyl-1-[4-[5-(methylamino)-6-(methylideneamino)-4,7-bis[4-(N-phenylanilino)phenyl]benzotriazol-2-yl]phenyl]piperidine-2,6-dione.
| Compound Name | 4,4-dimethyl-1-[4-[5-(methylamino)-6-(methylideneamino)-4,7-bis[4-(N-phenylanilino)phenyl]benzotriazol-2-yl]phenyl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 118534056 |
| Molecular Formula | C57H48N8O2 |
| Molecular Weight | 877.07 g/mol |
| Exact Mass | 876.39 |
| IUPAC Name | 4,4-dimethyl-1-[4-[5-(methylamino)-6-(methylideneamino)-4,7-bis[4-(N-phenylanilino)phenyl]benzotriazol-2-yl]phenyl]piperidine-2,6-dione |
| SMILES | C=Nc1c(NC)c(-c2ccc(N(c3ccccc3)c3ccccc3)cc2)c2nn(-c3ccc(N4C(=O)CC(C)(C)CC4=O)cc3)nc2c1-c1ccc(N(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C57H48N8O2/c1-57(2)37-49(66)64(50(67)38-57)47-33-35-48(36-34-47)65-60-55-51(39-25-29-45(30-26-39)62(41-17-9-5-10-18-41)42-19-11-6-12-20-42)53(58-3)54(59-4)52(56(55)61-65)40-27-31-46(32-28-40)63(43-21-13-7-14-22-43)44-23-15-8-16-24-44/h5-36,59H,3,37-38H2,1-2,4H3 |
| InChIKey | RFUKZKQTPCLBHX-UHFFFAOYSA-N |
| XLogP | 13.75 |
| TPSA | 98.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 67 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 877.07 |
| LogP ≤ 5 | 13.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|