C52H44N8 — CID 118530720
2-(2-methylpropyl)-4,7-bis[4-(N-phenylanilino)phenyl]-6-phenyldiazenylbenzotriazol-5-amine (PubChem CID 118530720) has the molecular formula C52H44N8 and a molecular weight of 780.98 g/mol. Its IUPAC name is 2-(2-methylpropyl)-4,7-bis[4-(N-phenylanilino)phenyl]-6-phenyldiazenylbenzotriazol-5-amine.
| Compound Name | 2-(2-methylpropyl)-4,7-bis[4-(N-phenylanilino)phenyl]-6-phenyldiazenylbenzotriazol-5-amine |
|---|---|
| PubChem CID | 118530720 |
| Molecular Formula | C52H44N8 |
| Molecular Weight | 780.98 g/mol |
| Exact Mass | 780.37 |
| IUPAC Name | 2-(2-methylpropyl)-4,7-bis[4-(N-phenylanilino)phenyl]-6-phenyldiazenylbenzotriazol-5-amine |
| SMILES | CC(C)Cn1nc2c(-c3ccc(N(c4ccccc4)c4ccccc4)cc3)c(N)c(/N=N/c3ccccc3)c(-c3ccc(N(c4ccccc4)c4ccccc4)cc3)c2n1 |
| InChI | InChI=1S/C52H44N8/c1-37(2)36-58-56-51-47(38-28-32-45(33-29-38)59(41-20-10-4-11-21-41)42-22-12-5-13-23-42)49(53)50(55-54-40-18-8-3-9-19-40)48(52(51)57-58)39-30-34-46(35-31-39)60(43-24-14-6-15-25-43)44-26-16-7-17-27-44/h3-35,37H,36,53H2,1-2H3/b55-54+ |
| InChIKey | WGAUBTYFGJAXHC-SBZZGWGOSA-N |
| XLogP | 14.36 |
| TPSA | 87.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 780.98 |
| LogP ≤ 5 | 14.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|