C62H63N7 — CID 177397871
9-(2-ethylhexyl)-3-N,6-N-bis(4-methylphenyl)-3-N,6-N-bis[4-[(E)-[methyl(phenyl)hydrazinylidene]methyl]phenyl]carbazole-3,6-diamine (PubChem CID 177397871) has the molecular formula C62H63N7 and a molecular weight of 906.24 g/mol. Its IUPAC name is 9-(2-ethylhexyl)-3-N,6-N-bis(4-methylphenyl)-3-N,6-N-bis[4-[(E)-[methyl(phenyl)hydrazinylidene]methyl]phenyl]carbazole-3,6-diamine.
| Compound Name | 9-(2-ethylhexyl)-3-N,6-N-bis(4-methylphenyl)-3-N,6-N-bis[4-[(E)-[methyl(phenyl)hydrazinylidene]methyl]phenyl]carbazole-3,6-diamine |
|---|---|
| PubChem CID | 177397871 |
| Molecular Formula | C62H63N7 |
| Molecular Weight | 906.24 g/mol |
| Exact Mass | 905.51 |
| IUPAC Name | 9-(2-ethylhexyl)-3-N,6-N-bis(4-methylphenyl)-3-N,6-N-bis[4-[(E)-[methyl(phenyl)hydrazinylidene]methyl]phenyl]carbazole-3,6-diamine |
| SMILES | CCCCC(CC)Cn1c2ccc(N(c3ccc(C)cc3)c3ccc(/C=N/N(C)c4ccccc4)cc3)cc2c2cc(N(c3ccc(C)cc3)c3ccc(/C=N/N(C)c4ccccc4)cc3)ccc21 |
| InChI | InChI=1S/C62H63N7/c1-7-9-16-48(8-2)45-67-61-39-37-57(68(53-29-21-46(3)22-30-53)55-33-25-49(26-34-55)43-63-65(5)51-17-12-10-13-18-51)41-59(61)60-42-58(38-40-62(60)67)69(54-31-23-47(4)24-32-54)56-35-27-50(28-36-56)44-64-66(6)52-19-14-11-15-20-52/h10-15,17-44,48H,7-9,16,45H2,1-6H3/b63-43+,64-44+ |
| InChIKey | IACAYSZQOIUNLE-GEPWDMARSA-N |
| XLogP | 16.51 |
| TPSA | 42.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 69 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 906.24 |
| LogP ≤ 5 | 16.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|