C28H33N3 — CID 20719215
N-[(E)-[9-(2-ethylhexyl)carbazol-3-yl]methylideneamino]-N-methylaniline (PubChem CID 20719215) has the molecular formula C28H33N3 and a molecular weight of 411.59 g/mol. Its IUPAC name is N-[(E)-[9-(2-ethylhexyl)carbazol-3-yl]methylideneamino]-N-methylaniline.
| Compound Name | N-[(E)-[9-(2-ethylhexyl)carbazol-3-yl]methylideneamino]-N-methylaniline |
|---|---|
| PubChem CID | 20719215 |
| Molecular Formula | C28H33N3 |
| Molecular Weight | 411.59 g/mol |
| Exact Mass | 411.27 |
| IUPAC Name | N-[(E)-[9-(2-ethylhexyl)carbazol-3-yl]methylideneamino]-N-methylaniline |
| SMILES | CCCCC(CC)Cn1c2ccccc2c2cc(/C=N/N(C)c3ccccc3)ccc21 |
| InChI | InChI=1S/C28H33N3/c1-4-6-12-22(5-2)21-31-27-16-11-10-15-25(27)26-19-23(17-18-28(26)31)20-29-30(3)24-13-8-7-9-14-24/h7-11,13-20,22H,4-6,12,21H2,1-3H3/b29-20+ |
| InChIKey | CVYGIJWOSUZNTM-ZTKZIYFRSA-N |
| XLogP | 7.48 |
| TPSA | 20.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.59 |
| LogP ≤ 5 | 7.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|