C34H33N5 — CID 59696037
5-methyl-N-[(Z)-(9-pentylcarbazol-3-yl)methylideneamino]-N,1-diphenylpyrazol-3-amine (PubChem CID 59696037) has the molecular formula C34H33N5 and a molecular weight of 511.67 g/mol. Its IUPAC name is 5-methyl-N-[(Z)-(9-pentylcarbazol-3-yl)methylideneamino]-N,1-diphenylpyrazol-3-amine.
| Compound Name | 5-methyl-N-[(Z)-(9-pentylcarbazol-3-yl)methylideneamino]-N,1-diphenylpyrazol-3-amine |
|---|---|
| PubChem CID | 59696037 |
| Molecular Formula | C34H33N5 |
| Molecular Weight | 511.67 g/mol |
| Exact Mass | 511.27 |
| IUPAC Name | 5-methyl-N-[(Z)-(9-pentylcarbazol-3-yl)methylideneamino]-N,1-diphenylpyrazol-3-amine |
| SMILES | CCCCCn1c2ccccc2c2cc(/C=N\N(c3ccccc3)c3cc(C)n(-c4ccccc4)n3)ccc21 |
| InChI | InChI=1S/C34H33N5/c1-3-4-13-22-37-32-19-12-11-18-30(32)31-24-27(20-21-33(31)37)25-35-39(29-16-9-6-10-17-29)34-23-26(2)38(36-34)28-14-7-5-8-15-28/h5-12,14-21,23-25H,3-4,13,22H2,1-2H3/b35-25- |
| InChIKey | HTWOMVFFRMNASI-CKWSZQMZSA-N |
| XLogP | 8.65 |
| TPSA | 38.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.67 |
| LogP ≤ 5 | 8.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|