C34H39N5 — CID 20761205
4-N-[4-(diethylamino)phenyl]-1-N,1-N-diethyl-4-N-[(E)-(9-methylcarbazol-3-yl)methylideneamino]benzene-1,4-diamine (PubChem CID 20761205) has the molecular formula C34H39N5 and a molecular weight of 517.72 g/mol. Its IUPAC name is 4-N-[4-(diethylamino)phenyl]-1-N,1-N-diethyl-4-N-[(E)-(9-methylcarbazol-3-yl)methylideneamino]benzene-1,4-diamine.
| Compound Name | 4-N-[4-(diethylamino)phenyl]-1-N,1-N-diethyl-4-N-[(E)-(9-methylcarbazol-3-yl)methylideneamino]benzene-1,4-diamine |
|---|---|
| PubChem CID | 20761205 |
| Molecular Formula | C34H39N5 |
| Molecular Weight | 517.72 g/mol |
| Exact Mass | 517.32 |
| IUPAC Name | 4-N-[4-(diethylamino)phenyl]-1-N,1-N-diethyl-4-N-[(E)-(9-methylcarbazol-3-yl)methylideneamino]benzene-1,4-diamine |
| SMILES | CCN(CC)c1ccc(N(/N=C/c2ccc3c(c2)c2ccccc2n3C)c2ccc(N(CC)CC)cc2)cc1 |
| InChI | InChI=1S/C34H39N5/c1-6-37(7-2)27-15-19-29(20-16-27)39(30-21-17-28(18-22-30)38(8-3)9-4)35-25-26-14-23-34-32(24-26)31-12-10-11-13-33(31)36(34)5/h10-25H,6-9H2,1-5H3/b35-25+ |
| InChIKey | XIHDPLHOELFLDV-KVQDIILNSA-N |
| XLogP | 8.20 |
| TPSA | 27.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.72 |
| LogP ≤ 5 | 8.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|