C50H52N6 — CID 87966041
N-[(E)-[4-(diethylamino)phenyl]methylideneamino]-N-phenylnaphthalen-1-amine;4-[(E)-(diphenylhydrazinylidene)methyl]-N,N-diethylaniline (PubChem CID 87966041) has the molecular formula C50H52N6 and a molecular weight of 737.01 g/mol. Its IUPAC name is N-[(E)-[4-(diethylamino)phenyl]methylideneamino]-N-phenylnaphthalen-1-amine;4-[(E)-(diphenylhydrazinylidene)methyl]-N,N-diethylaniline.
| Compound Name | N-[(E)-[4-(diethylamino)phenyl]methylideneamino]-N-phenylnaphthalen-1-amine;4-[(E)-(diphenylhydrazinylidene)methyl]-N,N-diethylaniline |
|---|---|
| PubChem CID | 87966041 |
| Molecular Formula | C50H52N6 |
| Molecular Weight | 737.01 g/mol |
| Exact Mass | 736.43 |
| IUPAC Name | N-[(E)-[4-(diethylamino)phenyl]methylideneamino]-N-phenylnaphthalen-1-amine;4-[(E)-(diphenylhydrazinylidene)methyl]-N,N-diethylaniline |
| SMILES | CCN(CC)c1ccc(/C=N/N(c2ccccc2)c2cccc3ccccc23)cc1.CCN(CC)c1ccc(/C=N/N(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C27H27N3.C23H25N3/c1-3-29(4-2)24-19-17-22(18-20-24)21-28-30(25-13-6-5-7-14-25)27-16-10-12-23-11-8-9-15-26(23)27;1-3-25(4-2)21-17-15-20(16-18-21)19-24-26(22-11-7-5-8-12-22)23-13-9-6-10-14-23/h5-21H,3-4H2,1-2H3;5-19H,3-4H2,1-2H3/b28-21+;24-19+ |
| InChIKey | UTPOSLUXYJRQAO-IQRVKJCYSA-N |
| XLogP | 12.56 |
| TPSA | 37.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 737.01 |
| LogP ≤ 5 | 12.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|