C22H23Br2N3S2 — CID 133083241
4,7-bis(5-bromothiophen-2-yl)-2-(2-ethylhexyl)benzotriazole (PubChem CID 133083241) has the molecular formula C22H23Br2N3S2 and a molecular weight of 553.39 g/mol. Its IUPAC name is 4,7-bis(5-bromothiophen-2-yl)-2-(2-ethylhexyl)benzotriazole.
| Compound Name | 4,7-bis(5-bromothiophen-2-yl)-2-(2-ethylhexyl)benzotriazole |
|---|---|
| PubChem CID | 133083241 |
| Molecular Formula | C22H23Br2N3S2 |
| Molecular Weight | 553.39 g/mol |
| Exact Mass | 550.97 |
| IUPAC Name | 4,7-bis(5-bromothiophen-2-yl)-2-(2-ethylhexyl)benzotriazole |
| SMILES | CCCCC(CC)Cn1nc2c(-c3ccc(Br)s3)ccc(-c3ccc(Br)s3)c2n1 |
| InChI | InChI=1S/C22H23Br2N3S2/c1-3-5-6-14(4-2)13-27-25-21-15(17-9-11-19(23)28-17)7-8-16(22(21)26-27)18-10-12-20(24)29-18/h7-12,14H,3-6,13H2,1-2H3 |
| InChIKey | JFTRHTGDYQVTME-UHFFFAOYSA-N |
| XLogP | 8.63 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.39 |
| LogP ≤ 5 | 8.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |