C40H61N3S2 — CID 90890394
2-(2-hexyldecyl)-4-(2-methylbutan-2-yl)-7-[5-[5-(2-methylbutan-2-yl)thiophen-2-yl]thiophen-2-yl]benzotriazole (PubChem CID 90890394) has the molecular formula C40H61N3S2 and a molecular weight of 648.08 g/mol. Its IUPAC name is 2-(2-hexyldecyl)-4-(2-methylbutan-2-yl)-7-[5-[5-(2-methylbutan-2-yl)thiophen-2-yl]thiophen-2-yl]benzotriazole.
| Compound Name | 2-(2-hexyldecyl)-4-(2-methylbutan-2-yl)-7-[5-[5-(2-methylbutan-2-yl)thiophen-2-yl]thiophen-2-yl]benzotriazole |
|---|---|
| PubChem CID | 90890394 |
| Molecular Formula | C40H61N3S2 |
| Molecular Weight | 648.08 g/mol |
| Exact Mass | 647.43 |
| IUPAC Name | 2-(2-hexyldecyl)-4-(2-methylbutan-2-yl)-7-[5-[5-(2-methylbutan-2-yl)thiophen-2-yl]thiophen-2-yl]benzotriazole |
| SMILES | CCCCCCCCC(CCCCCC)Cn1nc2c(-c3ccc(-c4ccc(C(C)(C)CC)s4)s3)ccc(C(C)(C)CC)c2n1 |
| InChI | InChI=1S/C40H61N3S2/c1-9-13-15-17-18-20-22-30(21-19-16-14-10-2)29-43-41-37-31(23-24-32(38(37)42-43)39(5,6)11-3)33-25-26-34(44-33)35-27-28-36(45-35)40(7,8)12-4/h23-28,30H,9-22,29H2,1-8H3 |
| InChIKey | OMEKSEVGHFJTBD-UHFFFAOYSA-N |
| XLogP | 13.60 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.08 |
| LogP ≤ 5 | 13.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|