C24H25Br2N5S3 — CID 170258852
2,8-bis(5-bromo-4-methylthiophen-2-yl)-11-(2-ethylhexyl)-5λ4-thia-4,6,10,11,12-pentazatricyclo[7.3.0.03,7]dodeca-1(12),2,4,5,7,9-hexaene (PubChem CID 170258852) has the molecular formula C24H25Br2N5S3 and a molecular weight of 639.51 g/mol. Its IUPAC name is 2,8-bis(5-bromo-4-methylthiophen-2-yl)-11-(2-ethylhexyl)-5λ4-thia-4,6,10,11,12-pentazatricyclo[7.3.0.03,7]dodeca-1(12),2,4,5,7,9-hexaene.
| Compound Name | 2,8-bis(5-bromo-4-methylthiophen-2-yl)-11-(2-ethylhexyl)-5λ4-thia-4,6,10,11,12-pentazatricyclo[7.3.0.03,7]dodeca-1(12),2,4,5,7,9-hexaene |
|---|---|
| PubChem CID | 170258852 |
| Molecular Formula | C24H25Br2N5S3 |
| Molecular Weight | 639.51 g/mol |
| Exact Mass | 636.96 |
| IUPAC Name | 2,8-bis(5-bromo-4-methylthiophen-2-yl)-11-(2-ethylhexyl)-5λ4-thia-4,6,10,11,12-pentazatricyclo[7.3.0.03,7]dodeca-1(12),2,4,5,7,9-hexaene |
| SMILES | CCCCC(CC)Cn1nc2c(-c3cc(C)c(Br)s3)c3c(c(-c4cc(C)c(Br)s4)c2n1)N=S=N3 |
| InChI | InChI=1S/C24H25Br2N5S3/c1-5-7-8-14(6-2)11-31-27-19-17(15-9-12(3)23(25)32-15)21-22(30-34-29-21)18(20(19)28-31)16-10-13(4)24(26)33-16/h9-10,14H,5-8,11H2,1-4H3 |
| InChIKey | HJTCNUYWBRBQMV-UHFFFAOYSA-N |
| XLogP | 9.97 |
| TPSA | 55.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 639.51 |
| LogP ≤ 5 | 9.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |