C26H36Br2N4S2 — CID 102264975
3,6-bis[5-bromo-4-(2-ethylhexyl)thiophen-2-yl]-1,2,4,5-tetrazine (PubChem CID 102264975) has the molecular formula C26H36Br2N4S2 and a molecular weight of 628.54 g/mol. Its IUPAC name is 3,6-bis[5-bromo-4-(2-ethylhexyl)thiophen-2-yl]-1,2,4,5-tetrazine.
| Compound Name | 3,6-bis[5-bromo-4-(2-ethylhexyl)thiophen-2-yl]-1,2,4,5-tetrazine |
|---|---|
| PubChem CID | 102264975 |
| Molecular Formula | C26H36Br2N4S2 |
| Molecular Weight | 628.54 g/mol |
| Exact Mass | 626.07 |
| IUPAC Name | 3,6-bis[5-bromo-4-(2-ethylhexyl)thiophen-2-yl]-1,2,4,5-tetrazine |
| SMILES | CCCCC(CC)Cc1cc(-c2nnc(-c3cc(CC(CC)CCCC)c(Br)s3)nn2)sc1Br |
| InChI | InChI=1S/C26H36Br2N4S2/c1-5-9-11-17(7-3)13-19-15-21(33-23(19)27)25-29-31-26(32-30-25)22-16-20(24(28)34-22)14-18(8-4)12-10-6-2/h15-18H,5-14H2,1-4H3 |
| InChIKey | RNZMRKMPTNFFOX-UHFFFAOYSA-N |
| XLogP | 9.77 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.54 |
| LogP ≤ 5 | 9.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |