C21H24BrN3S2 — CID 146288719
5-bromo-2-[5-[5-(2-ethylhexyl)thiophen-2-yl]thiophen-2-yl]pyridine-3,4-diimine (PubChem CID 146288719) has the molecular formula C21H24BrN3S2 and a molecular weight of 462.48 g/mol. Its IUPAC name is 5-bromo-2-[5-[5-(2-ethylhexyl)thiophen-2-yl]thiophen-2-yl]pyridine-3,4-diimine.
| Compound Name | 5-bromo-2-[5-[5-(2-ethylhexyl)thiophen-2-yl]thiophen-2-yl]pyridine-3,4-diimine |
|---|---|
| PubChem CID | 146288719 |
| Molecular Formula | C21H24BrN3S2 |
| Molecular Weight | 462.48 g/mol |
| Exact Mass | 461.06 |
| IUPAC Name | 5-bromo-2-[5-[5-(2-ethylhexyl)thiophen-2-yl]thiophen-2-yl]pyridine-3,4-diimine |
| SMILES | [H]/N=C1\C(Br)=CN=C(c2ccc(-c3ccc(CC(CC)CCCC)s3)s2)\C1=N\[H] |
| InChI | InChI=1S/C21H24BrN3S2/c1-3-5-6-13(4-2)11-14-7-8-16(26-14)17-9-10-18(27-17)21-20(24)19(23)15(22)12-25-21/h7-10,12-13,23-24H,3-6,11H2,1-2H3/b23-19+,24-20+ |
| InChIKey | MUZMMKUARYTUGW-BLVCXSLXSA-N |
| XLogP | 7.31 |
| TPSA | 60.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.48 |
| LogP ≤ 5 | 7.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|