C16H24S2 — CID 147295645
3-[5-(2-ethylhexyl)thiophen-2-yl]buta-1,3-diene-2-thiol (PubChem CID 147295645) has the molecular formula C16H24S2 and a molecular weight of 280.50 g/mol. Its IUPAC name is 3-[5-(2-ethylhexyl)thiophen-2-yl]buta-1,3-diene-2-thiol.
| Compound Name | 3-[5-(2-ethylhexyl)thiophen-2-yl]buta-1,3-diene-2-thiol |
|---|---|
| PubChem CID | 147295645 |
| Molecular Formula | C16H24S2 |
| Molecular Weight | 280.50 g/mol |
| Exact Mass | 280.13 |
| IUPAC Name | 3-[5-(2-ethylhexyl)thiophen-2-yl]buta-1,3-diene-2-thiol |
| SMILES | C=C(S)C(=C)c1ccc(CC(CC)CCCC)s1 |
| InChI | InChI=1S/C16H24S2/c1-5-7-8-14(6-2)11-15-9-10-16(18-15)12(3)13(4)17/h9-10,14,17H,3-8,11H2,1-2H3 |
| InChIKey | CVBMGDJXNBHDON-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.50 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|