C23H38S2Sn — CID 144587958
(2Z,5E)-3-[5-(2-ethylhexyl)thiophen-2-yl]-4-methylidene-6-trimethylstannylhepta-2,5-diene-2-thiol (PubChem CID 144587958) has the molecular formula C23H38S2Sn and a molecular weight of 497.40 g/mol. Its IUPAC name is (2Z,5E)-3-[5-(2-ethylhexyl)thiophen-2-yl]-4-methylidene-6-trimethylstannylhepta-2,5-diene-2-thiol.
| Compound Name | (2Z,5E)-3-[5-(2-ethylhexyl)thiophen-2-yl]-4-methylidene-6-trimethylstannylhepta-2,5-diene-2-thiol |
|---|---|
| PubChem CID | 144587958 |
| Molecular Formula | C23H38S2Sn |
| Molecular Weight | 497.40 g/mol |
| Exact Mass | 498.14 |
| IUPAC Name | (2Z,5E)-3-[5-(2-ethylhexyl)thiophen-2-yl]-4-methylidene-6-trimethylstannylhepta-2,5-diene-2-thiol |
| SMILES | C=C(/C=C(\C)[Sn](C)(C)C)/C(=C(\C)S)c1ccc(CC(CC)CCCC)s1 |
| InChI | InChI=1S/C20H29S2.3CH3.Sn/c1-6-9-11-17(8-3)14-18-12-13-19(22-18)20(16(5)21)15(4)10-7-2;;;;/h10,12-13,17,21H,4,6,8-9,11,14H2,1-3,5H3;3*1H3;/b10-7?,20-16-;;;; |
| InChIKey | XEVGSIBPYLBJQF-AVPXGPEQSA-N |
| XLogP | 8.55 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.40 |
| LogP ≤ 5 | 8.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|