C26H40S3Sn — CID 144587984
ethane;4-[5-(2-ethylhexyl)thiophen-2-yl]-6-methyl-2-trimethylstannyl-1-benzothiophene-5-thiol (PubChem CID 144587984) has the molecular formula C26H40S3Sn and a molecular weight of 567.52 g/mol. Its IUPAC name is ethane;4-[5-(2-ethylhexyl)thiophen-2-yl]-6-methyl-2-trimethylstannyl-1-benzothiophene-5-thiol.
| Compound Name | ethane;4-[5-(2-ethylhexyl)thiophen-2-yl]-6-methyl-2-trimethylstannyl-1-benzothiophene-5-thiol |
|---|---|
| PubChem CID | 144587984 |
| Molecular Formula | C26H40S3Sn |
| Molecular Weight | 567.52 g/mol |
| Exact Mass | 568.13 |
| IUPAC Name | ethane;4-[5-(2-ethylhexyl)thiophen-2-yl]-6-methyl-2-trimethylstannyl-1-benzothiophene-5-thiol |
| SMILES | CC.CCCCC(CC)Cc1ccc(-c2c(S)c(C)cc3sc([Sn](C)(C)C)cc23)s1 |
| InChI | InChI=1S/C21H25S3.C2H6.3CH3.Sn/c1-4-6-7-15(5-2)13-16-8-9-18(24-16)20-17-10-11-23-19(17)12-14(3)21(20)22;1-2;;;;/h8-10,12,15,22H,4-7,13H2,1-3H3;1-2H3;3*1H3; |
| InChIKey | VPAQFKMKJNMENU-UHFFFAOYSA-N |
| XLogP | 9.56 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.52 |
| LogP ≤ 5 | 9.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|