C28H54SSn — CID 140776373
tributyl-[5-(2-butyloctyl)thiophen-2-yl]stannane (PubChem CID 140776373) has the molecular formula C28H54SSn and a molecular weight of 541.52 g/mol. Its IUPAC name is tributyl-[5-(2-butyloctyl)thiophen-2-yl]stannane.
| Compound Name | tributyl-[5-(2-butyloctyl)thiophen-2-yl]stannane |
|---|---|
| PubChem CID | 140776373 |
| Molecular Formula | C28H54SSn |
| Molecular Weight | 541.52 g/mol |
| Exact Mass | 542.30 |
| IUPAC Name | tributyl-[5-(2-butyloctyl)thiophen-2-yl]stannane |
| SMILES | CCCCCCC(CCCC)Cc1ccc([Sn](CCCC)(CCCC)CCCC)s1 |
| InChI | InChI=1S/C16H27S.3C4H9.Sn/c1-3-5-7-8-11-15(10-6-4-2)14-16-12-9-13-17-16;3*1-3-4-2;/h9,12,15H,3-8,10-11,14H2,1-2H3;3*1,3-4H2,2H3; |
| InChIKey | CGZRKHVNGKEJQS-UHFFFAOYSA-N |
| XLogP | 10.12 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.52 |
| LogP ≤ 5 | 10.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|